ChemNet > CAS > 321309-32-4 1,2,3-benzothiadiazole-5-carbonyl chloride
321309-32-4 1,2,3-benzothiadiazole-5-carbonyl chloride
termék neve |
1,2,3-benzothiadiazole-5-carbonyl chloride |
MF |
C7H3ClN2OS |
Molekulatömeg |
198.6295 |
InChI |
InChI=1/C7H3ClN2OS/c8-7(11)4-1-2-6-5(3-4)9-10-12-6/h1-3H |
CAS-szám |
321309-32-4 |
Molekuláris szerkezete |
|
Sűrűség |
1.577g/cm3 |
Olvadáspont |
94℃ |
Forráspont |
311°C at 760 mmHg |
Törésmutató |
1.704 |
Gyulladáspont |
141.9°C |
Veszély szimbólumok |
C:Corrosive;
|
Kockázatot kódok |
R34:Causes burns.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|